C20H22N2O — CID 123311367
(NE)-N-(1'-benzylspiro[2H-indene-3,4'-piperidine]-1-ylidene)hydroxylamine (PubChem CID 123311367) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (NE)-N-(1'-benzylspiro[2H-indene-3,4'-piperidine]-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(1'-benzylspiro[2H-indene-3,4'-piperidine]-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 123311367 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (NE)-N-(1'-benzylspiro[2H-indene-3,4'-piperidine]-1-ylidene)hydroxylamine |
| SMILES | O/N=C1\CC2(CCN(Cc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O/c23-21-19-14-20(18-9-5-4-8-17(18)19)10-12-22(13-11-20)15-16-6-2-1-3-7-16/h1-9,23H,10-15H2/b21-19+ |
| InChIKey | KAUPZGAJWGWSOL-XUTLUUPISA-N |
| XLogP | 3.80 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|