C20H21ClN2O2 — CID 88869998
(NE)-N-(1'-benzyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-ylidene)hydroxylamine (PubChem CID 88869998) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is (NE)-N-(1'-benzyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(1'-benzyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 88869998 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (NE)-N-(1'-benzyl-8-chlorospiro[3H-chromene-2,4'-piperidine]-4-ylidene)hydroxylamine |
| SMILES | O/N=C1\CC2(CCN(Cc3ccccc3)CC2)Oc2c(Cl)cccc21 |
| InChI | InChI=1S/C20H21ClN2O2/c21-17-8-4-7-16-18(22-24)13-20(25-19(16)17)9-11-23(12-10-20)14-15-5-2-1-3-6-15/h1-8,24H,9-14H2/b22-18+ |
| InChIKey | JFHCJIXRSGCGLR-RELWKKBWSA-N |
| XLogP | 4.34 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|