C23H26N2O2 — CID 70823758
benzyl 3-ethyliminospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (PubChem CID 70823758) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is benzyl 3-ethyliminospiro[2H-indene-1,4'-piperidine]-1'-carboxylate.
| Compound Name | benzyl 3-ethyliminospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 70823758 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | benzyl 3-ethyliminospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| SMILES | CC/N=C1\CC2(CCN(C(=O)OCc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O2/c1-2-24-21-16-23(20-11-7-6-10-19(20)21)12-14-25(15-13-23)22(26)27-17-18-8-4-3-5-9-18/h3-11H,2,12-17H2,1H3/b24-21+ |
| InChIKey | FPOMAICBZXRTRR-DARPEHSRSA-N |
| XLogP | 4.57 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|