C21H21NO3 — CID 59433376
benzyl 3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (PubChem CID 59433376) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is benzyl 3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate.
| Compound Name | benzyl 3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 59433376 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | benzyl 3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| SMILES | O=C1CC2(CCN(C(=O)OCc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H21NO3/c23-19-14-21(18-9-5-4-8-17(18)19)10-12-22(13-11-21)20(24)25-15-16-6-2-1-3-7-16/h1-9H,10-15H2 |
| InChIKey | QCXFRICPLQOHKM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |