C18H19N3O4 — CID 21275427
benzyl 2-(cyanomethyl)-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 21275427) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is benzyl 2-(cyanomethyl)-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | benzyl 2-(cyanomethyl)-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 21275427 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | benzyl 2-(cyanomethyl)-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | N#CCN1C(=O)CC2(CCN(C(=O)OCc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C18H19N3O4/c19-8-11-21-15(22)12-18(16(21)23)6-9-20(10-7-18)17(24)25-13-14-4-2-1-3-5-14/h1-5H,6-7,9-13H2 |
| InChIKey | ZTMKNFCFQSSVIW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|