C20H23NO — CID 12706476
1'-benzylspiro[1,3-dihydroisochromene-4,4'-piperidine] (PubChem CID 12706476) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 1'-benzylspiro[1,3-dihydroisochromene-4,4'-piperidine].
| Compound Name | 1'-benzylspiro[1,3-dihydroisochromene-4,4'-piperidine] |
|---|---|
| PubChem CID | 12706476 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1'-benzylspiro[1,3-dihydroisochromene-4,4'-piperidine] |
| SMILES | c1ccc(CN2CCC3(CC2)COCc2ccccc23)cc1 |
| InChI | InChI=1S/C20H23NO/c1-2-6-17(7-3-1)14-21-12-10-20(11-13-21)16-22-15-18-8-4-5-9-19(18)20/h1-9H,10-16H2 |
| InChIKey | BDQSEUUZQUPTHA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |