C16H22N2O — CID 118960394
9-benzyl-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 118960394) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 9-benzyl-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 9-benzyl-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 118960394 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 9-benzyl-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C1NCCCC12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C16H22N2O/c19-15-16(7-4-10-17-15)8-11-18(12-9-16)13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2,(H,17,19) |
| InChIKey | RXMJZCGXCZAXMD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |