C11H6F6O — CID 10015841
2,2-bis(trifluoromethyl)-3H-inden-1-one (PubChem CID 10015841) has the molecular formula C11H6F6O and a molecular weight of 268.16 g/mol. Its IUPAC name is 2,2-bis(trifluoromethyl)-3H-inden-1-one.
| Compound Name | 2,2-bis(trifluoromethyl)-3H-inden-1-one |
|---|---|
| PubChem CID | 10015841 |
| Molecular Formula | C11H6F6O |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2,2-bis(trifluoromethyl)-3H-inden-1-one |
| SMILES | O=C1c2ccccc2CC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F6O/c12-10(13,14)9(11(15,16)17)5-6-3-1-2-4-7(6)8(9)18/h1-4H,5H2 |
| InChIKey | PQGQVQJKMKHTCO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |