C12H14O3 — CID 112715921
spiro[6,7-dihydro-2-benzofuran-5,4'-oxane]-4-one (PubChem CID 112715921) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is spiro[6,7-dihydro-2-benzofuran-5,4'-oxane]-4-one.
| Compound Name | spiro[6,7-dihydro-2-benzofuran-5,4'-oxane]-4-one |
|---|---|
| PubChem CID | 112715921 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | spiro[6,7-dihydro-2-benzofuran-5,4'-oxane]-4-one |
| SMILES | O=C1c2cocc2CCC12CCOCC2 |
| InChI | InChI=1S/C12H14O3/c13-11-10-8-15-7-9(10)1-2-12(11)3-5-14-6-4-12/h7-8H,1-6H2 |
| InChIKey | BCTKCEQOQJCNHA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |