C20H17NO2 — CID 58198220
6-(3-isocyanophenyl)spiro[3H-indene-2,4'-oxane]-1-one (PubChem CID 58198220) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-oxane]-1-one.
| Compound Name | 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-oxane]-1-one |
|---|---|
| PubChem CID | 58198220 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-oxane]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CCOCC2)C3)c1 |
| InChI | InChI=1S/C20H17NO2/c1-21-17-4-2-3-14(11-17)15-5-6-16-13-20(7-9-23-10-8-20)19(22)18(16)12-15/h2-6,11-12H,7-10,13H2 |
| InChIKey | ZEQFTMUJUTVAGC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|