C16H17NO3 — CID 134847830
6'-hydroxy-1'-prop-2-enylspiro[3H-indene-2,3'-piperidine]-1,2'-dione (PubChem CID 134847830) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 6'-hydroxy-1'-prop-2-enylspiro[3H-indene-2,3'-piperidine]-1,2'-dione.
| Compound Name | 6'-hydroxy-1'-prop-2-enylspiro[3H-indene-2,3'-piperidine]-1,2'-dione |
|---|---|
| PubChem CID | 134847830 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 6'-hydroxy-1'-prop-2-enylspiro[3H-indene-2,3'-piperidine]-1,2'-dione |
| SMILES | C=CCN1C(=O)C2(CCC1O)Cc1ccccc1C2=O |
| InChI | InChI=1S/C16H17NO3/c1-2-9-17-13(18)7-8-16(15(17)20)10-11-5-3-4-6-12(11)14(16)19/h2-6,13,18H,1,7-10H2 |
| InChIKey | KUUSSPPFDMSEHF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|