C21H19NO2 — CID 132533577
3-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)-2-prop-2-enyl-3H-isoindol-1-one (PubChem CID 132533577) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)-2-prop-2-enyl-3H-isoindol-1-one.
| Compound Name | 3-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)-2-prop-2-enyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 132533577 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-(2-oxo-3,4-dihydro-1H-naphthalen-1-yl)-2-prop-2-enyl-3H-isoindol-1-one |
| SMILES | C=CCN1C(=O)c2ccccc2C1C1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C21H19NO2/c1-2-13-22-20(16-9-5-6-10-17(16)21(22)24)19-15-8-4-3-7-14(15)11-12-18(19)23/h2-10,19-20H,1,11-13H2 |
| InChIKey | JMPBBXUZVOFKMT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|