C15H21NO — CID 91165098
propane;2-prop-2-enyl-3,4-dihydroisoquinolin-1-one (PubChem CID 91165098) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is propane;2-prop-2-enyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | propane;2-prop-2-enyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 91165098 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | propane;2-prop-2-enyl-3,4-dihydroisoquinolin-1-one |
| SMILES | C=CCN1CCc2ccccc2C1=O.CCC |
| InChI | InChI=1S/C12H13NO.C3H8/c1-2-8-13-9-7-10-5-3-4-6-11(10)12(13)14;1-3-2/h2-6H,1,7-9H2;3H2,1-2H3 |
| InChIKey | UEXQBWNAYRTAPK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|