C11H12N2O — CID 166583854
2-prop-2-enyl-3,4-dihydro-2,7-naphthyridin-1-one (PubChem CID 166583854) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-prop-2-enyl-3,4-dihydro-2,7-naphthyridin-1-one.
| Compound Name | 2-prop-2-enyl-3,4-dihydro-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 166583854 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-prop-2-enyl-3,4-dihydro-2,7-naphthyridin-1-one |
| SMILES | C=CCN1CCc2ccncc2C1=O |
| InChI | InChI=1S/C11H12N2O/c1-2-6-13-7-4-9-3-5-12-8-10(9)11(13)14/h2-3,5,8H,1,4,6-7H2 |
| InChIKey | IWTDAJSJUUDQBC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|