C16H26N2O2Si — CID 101456517
2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1H-pyrrolo[3,4-c]pyridin-3-one (PubChem CID 101456517) has the molecular formula C16H26N2O2Si and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1H-pyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1H-pyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 101456517 |
| Molecular Formula | C16H26N2O2Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1H-pyrrolo[3,4-c]pyridin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCN1Cc2ccncc2C1=O |
| InChI | InChI=1S/C16H26N2O2Si/c1-16(2,3)21(4,5)20-10-6-9-18-12-13-7-8-17-11-14(13)15(18)19/h7-8,11H,6,9-10,12H2,1-5H3 |
| InChIKey | IRDYEJKAWPVULY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|