C11H14N2O2 — CID 23394084
ethyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (PubChem CID 23394084) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is ethyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate.
| Compound Name | ethyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 23394084 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethyl 3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2ccncc2C1 |
| InChI | InChI=1S/C11H14N2O2/c1-2-15-11(14)13-6-4-9-3-5-12-7-10(9)8-13/h3,5,7H,2,4,6,8H2,1H3 |
| InChIKey | IWHBWWGLMIJZCG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |