C12H13NO3 — CID 129306058
2-[7-(hydroxymethyl)-1-oxo-3,4-dihydroisoquinolin-2-yl]acetaldehyde (PubChem CID 129306058) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[7-(hydroxymethyl)-1-oxo-3,4-dihydroisoquinolin-2-yl]acetaldehyde.
| Compound Name | 2-[7-(hydroxymethyl)-1-oxo-3,4-dihydroisoquinolin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 129306058 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[7-(hydroxymethyl)-1-oxo-3,4-dihydroisoquinolin-2-yl]acetaldehyde |
| SMILES | O=CCN1CCc2ccc(CO)cc2C1=O |
| InChI | InChI=1S/C12H13NO3/c14-6-5-13-4-3-10-2-1-9(8-15)7-11(10)12(13)16/h1-2,6-7,15H,3-5,8H2 |
| InChIKey | DXXPGPRUKRFTCR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|