C14H19N2OP — CID 59550564
1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-piperidine]-2'-one (PubChem CID 59550564) has the molecular formula C14H19N2OP and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-piperidine]-2'-one.
| Compound Name | 1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-piperidine]-2'-one |
|---|---|
| PubChem CID | 59550564 |
| Molecular Formula | C14H19N2OP |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-piperidine]-2'-one |
| SMILES | O=C1NCCCC12CCN(P)c1ccccc1C2 |
| InChI | InChI=1S/C14H19N2OP/c17-13-14(6-3-8-15-13)7-9-16(18)12-5-2-1-4-11(12)10-14/h1-2,4-5H,3,6-10,18H2,(H,15,17) |
| InChIKey | IEMQOZBVQIUPQK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|