C17H22NO3P — CID 59550601
ethyl 2'-oxo-1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-cyclopentane]-1'-carboxylate (PubChem CID 59550601) has the molecular formula C17H22NO3P and a molecular weight of 319.34 g/mol. Its IUPAC name is ethyl 2'-oxo-1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-cyclopentane]-1'-carboxylate.
| Compound Name | ethyl 2'-oxo-1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-cyclopentane]-1'-carboxylate |
|---|---|
| PubChem CID | 59550601 |
| Molecular Formula | C17H22NO3P |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | ethyl 2'-oxo-1-phosphanylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-cyclopentane]-1'-carboxylate |
| SMILES | CCOC(=O)C1CCC2(CCN(P)c3ccccc3C2)C1=O |
| InChI | InChI=1S/C17H22NO3P/c1-2-21-16(20)13-7-8-17(15(13)19)9-10-18(22)14-6-4-3-5-12(14)11-17/h3-6,13H,2,7-11,22H2,1H3 |
| InChIKey | KQUVKKFQRHBIQR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|