C16H21NO2 — CID 7071530
ethyl (3R)-3-ethyl-1-imino-3-methyl-2,4-dihydronaphthalene-2-carboxylate (PubChem CID 7071530) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl (3R)-3-ethyl-1-imino-3-methyl-2,4-dihydronaphthalene-2-carboxylate.
| Compound Name | ethyl (3R)-3-ethyl-1-imino-3-methyl-2,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7071530 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethyl (3R)-3-ethyl-1-imino-3-methyl-2,4-dihydronaphthalene-2-carboxylate |
| SMILES | [H]/N=C1\c2ccccc2C[C@@](C)(CC)C1C(=O)OCC |
| InChI | InChI=1S/C16H21NO2/c1-4-16(3)10-11-8-6-7-9-12(11)14(17)13(16)15(18)19-5-2/h6-9,13,17H,4-5,10H2,1-3H3/b17-14+/t13?,16-/m1/s1 |
| InChIKey | PLIQDTTZCSETDI-XKFZTFICSA-N |
| XLogP | 3.21 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|