C12H18O4 — CID 118947222
5-cyclohexyl-5-ethyl-1,3-dioxane-4,6-dione (PubChem CID 118947222) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 5-cyclohexyl-5-ethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-cyclohexyl-5-ethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 118947222 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 5-cyclohexyl-5-ethyl-1,3-dioxane-4,6-dione |
| SMILES | CCC1(C2CCCCC2)C(=O)OCOC1=O |
| InChI | InChI=1S/C12H18O4/c1-2-12(9-6-4-3-5-7-9)10(13)15-8-16-11(12)14/h9H,2-8H2,1H3 |
| InChIKey | LDFRTURSRAZTTQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|