C5H2O5 — CID 122223194
furo[3,4-d][1,3]dioxole-4,6-dione (PubChem CID 122223194) has the molecular formula C5H2O5 and a molecular weight of 142.07 g/mol. Its IUPAC name is furo[3,4-d][1,3]dioxole-4,6-dione.
| Compound Name | furo[3,4-d][1,3]dioxole-4,6-dione |
|---|---|
| PubChem CID | 122223194 |
| Molecular Formula | C5H2O5 |
| Molecular Weight | 142.07 g/mol |
| Exact Mass | 141.99 |
| IUPAC Name | furo[3,4-d][1,3]dioxole-4,6-dione |
| SMILES | O=C1OC(=O)C2=C1OCO2 |
| InChI | InChI=1S/C5H2O5/c6-4-2-3(5(7)10-4)9-1-8-2/h1H2 |
| InChIKey | QJHAZLSDVCCBLV-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.07 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|