C15H16O14 — CID 172689316
1,9-dihydroxy-4,6,12,14,18,20-hexaoxabicyclo[7.7.5]henicosane-3,7,11,15,17,21-hexone (PubChem CID 172689316) has the molecular formula C15H16O14 and a molecular weight of 420.28 g/mol. Its IUPAC name is 1,9-dihydroxy-4,6,12,14,18,20-hexaoxabicyclo[7.7.5]henicosane-3,7,11,15,17,21-hexone.
| Compound Name | 1,9-dihydroxy-4,6,12,14,18,20-hexaoxabicyclo[7.7.5]henicosane-3,7,11,15,17,21-hexone |
|---|---|
| PubChem CID | 172689316 |
| Molecular Formula | C15H16O14 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 1,9-dihydroxy-4,6,12,14,18,20-hexaoxabicyclo[7.7.5]henicosane-3,7,11,15,17,21-hexone |
| SMILES | O=C1CC2(O)CC(=O)OCOC(=O)CC(O)(CC(=O)OCO1)C(=O)OCOC2=O |
| InChI | InChI=1S/C15H16O14/c16-8-1-14(22)2-9(17)26-6-27-11(19)4-15(23,3-10(18)25-5-24-8)13(21)29-7-28-12(14)20/h22-23H,1-7H2 |
| InChIKey | BLPXCHSEIJOBIJ-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|