C18H15Bi3O21 — CID 140574767
5-hydroxy-2,8,9-trioxa-1-bismabicyclo[3.3.2]decane-3,7,10-trione (PubChem CID 140574767) has the molecular formula C18H15Bi3O21 and a molecular weight of 1194.24 g/mol. Its IUPAC name is 5-hydroxy-2,8,9-trioxa-1-bismabicyclo[3.3.2]decane-3,7,10-trione.
| Compound Name | 5-hydroxy-2,8,9-trioxa-1-bismabicyclo[3.3.2]decane-3,7,10-trione |
|---|---|
| PubChem CID | 140574767 |
| Molecular Formula | C18H15Bi3O21 |
| Molecular Weight | 1194.24 g/mol |
| Exact Mass | 1193.95 |
| IUPAC Name | 5-hydroxy-2,8,9-trioxa-1-bismabicyclo[3.3.2]decane-3,7,10-trione |
| SMILES | O=C1CC2(O)CC(=O)O[Bi](O1)OC2=O.O=C1CC2(O)CC(=O)O[Bi](O1)OC2=O.O=C1CC2(O)CC(=O)O[Bi](O1)OC2=O |
| InChI | InChI=1S/3C6H8O7.3Bi/c3*7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h3*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;;;3*+3/p-9 |
| InChIKey | MSSHDJQKKHDFBT-UHFFFAOYSA-E |
| XLogP | -5.58 |
| TPSA | 297.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1194.24 |
| LogP ≤ 5 | -5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |