C8H9NO10 — CID 139988697
5-hydroxy-1-(trihydroxymethylamino)-2,8,9-trioxabicyclo[3.3.2]decane-3,7,10-trione (PubChem CID 139988697) has the molecular formula C8H9NO10 and a molecular weight of 279.16 g/mol. Its IUPAC name is 5-hydroxy-1-(trihydroxymethylamino)-2,8,9-trioxabicyclo[3.3.2]decane-3,7,10-trione.
| Compound Name | 5-hydroxy-1-(trihydroxymethylamino)-2,8,9-trioxabicyclo[3.3.2]decane-3,7,10-trione |
|---|---|
| PubChem CID | 139988697 |
| Molecular Formula | C8H9NO10 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 5-hydroxy-1-(trihydroxymethylamino)-2,8,9-trioxabicyclo[3.3.2]decane-3,7,10-trione |
| SMILES | O=C1CC2(O)CC(=O)OC(NC(O)(O)O)(O1)OC2=O |
| InChI | InChI=1S/C8H9NO10/c10-3-1-6(13)2-4(11)18-8(17-3,19-5(6)12)9-7(14,15)16/h9,13-16H,1-2H2 |
| InChIKey | OITQPTPXQSALLY-UHFFFAOYSA-N |
| XLogP | -4.06 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|