C10H9NO9 — CID 141069897
9-hydroxy-2,6,12,13-tetraoxa-5-azatricyclo[7.3.2.11,5]pentadecane-7,11,14,15-tetrone (PubChem CID 141069897) has the molecular formula C10H9NO9 and a molecular weight of 287.18 g/mol. Its IUPAC name is 9-hydroxy-2,6,12,13-tetraoxa-5-azatricyclo[7.3.2.11,5]pentadecane-7,11,14,15-tetrone.
| Compound Name | 9-hydroxy-2,6,12,13-tetraoxa-5-azatricyclo[7.3.2.11,5]pentadecane-7,11,14,15-tetrone |
|---|---|
| PubChem CID | 141069897 |
| Molecular Formula | C10H9NO9 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 9-hydroxy-2,6,12,13-tetraoxa-5-azatricyclo[7.3.2.11,5]pentadecane-7,11,14,15-tetrone |
| SMILES | O=C1CC2(O)CC(=O)OC3(OCCN(O1)C3=O)OC2=O |
| InChI | InChI=1S/C10H9NO9/c12-5-3-9(16)4-6(13)20-11-1-2-17-10(18-5,7(11)14)19-8(9)15/h16H,1-4H2 |
| InChIKey | JUJDLAXZZIDBQG-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |