C10H9NO8 — CID 142590932
(1Z)-6-hydroxy-4,8,12-trioxo-3,9,11-trioxabicyclo[4.4.2]dodec-1-ene-2-carboxamide (PubChem CID 142590932) has the molecular formula C10H9NO8 and a molecular weight of 271.18 g/mol. Its IUPAC name is (1Z)-6-hydroxy-4,8,12-trioxo-3,9,11-trioxabicyclo[4.4.2]dodec-1-ene-2-carboxamide.
| Compound Name | (1Z)-6-hydroxy-4,8,12-trioxo-3,9,11-trioxabicyclo[4.4.2]dodec-1-ene-2-carboxamide |
|---|---|
| PubChem CID | 142590932 |
| Molecular Formula | C10H9NO8 |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | (1Z)-6-hydroxy-4,8,12-trioxo-3,9,11-trioxabicyclo[4.4.2]dodec-1-ene-2-carboxamide |
| SMILES | NC(=O)/C1=C2/COC(=O)CC(O)(CC(=O)O1)C(=O)O2 |
| InChI | InChI=1S/C10H9NO8/c11-8(14)7-4-3-17-5(12)1-10(16,9(15)18-4)2-6(13)19-7/h16H,1-3H2,(H2,11,14)/b7-4+ |
| InChIKey | FZWYKYFLRMPNLS-QPJJXVBHSA-N |
| XLogP | -2.15 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|