C5H8O4 — CID 160896103
1,4-dioxane-2,5-dione;methane (PubChem CID 160896103) has the molecular formula C5H8O4 and a molecular weight of 132.12 g/mol. Its IUPAC name is 1,4-dioxane-2,5-dione;methane.
| Compound Name | 1,4-dioxane-2,5-dione;methane |
|---|---|
| PubChem CID | 160896103 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 1,4-dioxane-2,5-dione;methane |
| SMILES | C.O=C1COC(=O)CO1 |
| InChI | InChI=1S/C4H4O4.CH4/c5-3-1-7-4(6)2-8-3;/h1-2H2;1H4 |
| InChIKey | SOWWJABRLIXQSS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |