C10H14O4 — CID 156904960
3-cyclohexyl-3-hydroxyoxolane-2,5-dione (PubChem CID 156904960) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-cyclohexyl-3-hydroxyoxolane-2,5-dione.
| Compound Name | 3-cyclohexyl-3-hydroxyoxolane-2,5-dione |
|---|---|
| PubChem CID | 156904960 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-cyclohexyl-3-hydroxyoxolane-2,5-dione |
| SMILES | O=C1CC(O)(C2CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C10H14O4/c11-8-6-10(13,9(12)14-8)7-4-2-1-3-5-7/h7,13H,1-6H2 |
| InChIKey | CHARSUGUKWMKEY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|