C8H10O5 — CID 166696428
2,2,5-trimethyl-4,6-dioxo-1,3-dioxane-5-carbaldehyde (PubChem CID 166696428) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is 2,2,5-trimethyl-4,6-dioxo-1,3-dioxane-5-carbaldehyde.
| Compound Name | 2,2,5-trimethyl-4,6-dioxo-1,3-dioxane-5-carbaldehyde |
|---|---|
| PubChem CID | 166696428 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2,2,5-trimethyl-4,6-dioxo-1,3-dioxane-5-carbaldehyde |
| SMILES | CC1(C)OC(=O)C(C)(C=O)C(=O)O1 |
| InChI | InChI=1S/C8H10O5/c1-7(2)12-5(10)8(3,4-9)6(11)13-7/h4H,1-3H3 |
| InChIKey | PNYOZILTTSQOIM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|