C7H8Br2O4 — CID 122463324
(6E)-5,5-dibromo-6-(hydroxymethylidene)-2,2-dimethyl-1,3-dioxan-4-one (PubChem CID 122463324) has the molecular formula C7H8Br2O4 and a molecular weight of 315.95 g/mol. Its IUPAC name is (6E)-5,5-dibromo-6-(hydroxymethylidene)-2,2-dimethyl-1,3-dioxan-4-one.
| Compound Name | (6E)-5,5-dibromo-6-(hydroxymethylidene)-2,2-dimethyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 122463324 |
| Molecular Formula | C7H8Br2O4 |
| Molecular Weight | 315.95 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | (6E)-5,5-dibromo-6-(hydroxymethylidene)-2,2-dimethyl-1,3-dioxan-4-one |
| SMILES | CC1(C)OC(=O)C(Br)(Br)/C(=C\O)O1 |
| InChI | InChI=1S/C7H8Br2O4/c1-6(2)12-4(3-10)7(8,9)5(11)13-6/h3,10H,1-2H3/b4-3+ |
| InChIKey | IROHKAPQKDYMES-ONEGZZNKSA-N |
| XLogP | 2.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.95 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|