C6H6O4S — CID 101415621
2,2-dimethyl-5-sulfanylidene-1,3-dioxane-4,6-dione (PubChem CID 101415621) has the molecular formula C6H6O4S and a molecular weight of 174.18 g/mol. Its IUPAC name is 2,2-dimethyl-5-sulfanylidene-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-sulfanylidene-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 101415621 |
| Molecular Formula | C6H6O4S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 2,2-dimethyl-5-sulfanylidene-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=S)C(=O)O1 |
| InChI | InChI=1S/C6H6O4S/c1-6(2)9-4(7)3(11)5(8)10-6/h1-2H3 |
| InChIKey | NJEOJVBCCDYOPG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|