About 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one
2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one (PubChem CID 15001690) has the molecular formula C8H9F3O3
and a molecular weight of 210.15 g/mol. Its IUPAC name is 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one.
Analyze 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one?
The IUPAC name of 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one (CID 15001690) is 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one.
What is the SMILES notation for 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one?
The canonical SMILES for 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one is CC1=C(C(F)(F)F)C(=O)OC(C)(C)O1.
What is the InChIKey of 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one?
The InChIKey is AEOHOWUUHSXLPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3O3/c1-4-5(8(9,10)11)6(12)14-7(2,3)13-4/h1-3H3.
What are the key properties of 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one?
2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one has a molecular weight of 210.15 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,6-trimethyl-5-(trifluoromethyl)-1,3-dioxin-4-one is sourced from PubChem (CID 15001690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).