C16H10F8O4 — CID 168598988
2,2-dimethyl-5-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168598988) has the molecular formula C16H10F8O4 and a molecular weight of 418.24 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598988 |
| Molecular Formula | C16H10F8O4 |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2,2-dimethyl-5-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(C(F)(F)F)c(C(F)(F)C(F)(F)F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H10F8O4/c1-13(2)27-11(25)8(12(26)28-13)5-7-3-4-9(15(19,20)21)10(6-7)14(17,18)16(22,23)24/h3-6H,1-2H3 |
| InChIKey | XSHIDWYEGTZTTD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|