C17H14F6O6 — CID 168599568
5-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599568) has the molecular formula C17H14F6O6 and a molecular weight of 428.28 g/mol. Its IUPAC name is 5-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599568 |
| Molecular Formula | C17H14F6O6 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 5-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc(C=C2C(=O)OC(C)(C)OC2=O)ccc1OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C17H14F6O6/c1-15(2)28-12(24)9(13(25)29-15)6-8-4-5-10(11(7-8)26-3)27-17(22,23)14(18)16(19,20)21/h4-7,14H,1-3H3 |
| InChIKey | WCQNYDPUPAXKNK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|