C13H11BrO5 — CID 168600320
5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168600320) has the molecular formula C13H11BrO5 and a molecular weight of 327.13 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168600320 |
| Molecular Formula | C13H11BrO5 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 5-[(3-bromo-4-hydroxyphenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(O)c(Br)c2)C(=O)O1 |
| InChI | InChI=1S/C13H11BrO5/c1-13(2)18-11(16)8(12(17)19-13)5-7-3-4-10(15)9(14)6-7/h3-6,15H,1-2H3 |
| InChIKey | WYULAMGJMLXPOF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|