C16H17NO7 — CID 4658550
2-tert-butyl-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2-methyl-1,3-dioxane-4,6-dione (PubChem CID 4658550) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is 2-tert-butyl-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2-methyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-tert-butyl-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2-methyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 4658550 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-tert-butyl-5-[(4-hydroxy-3-nitrophenyl)methylidene]-2-methyl-1,3-dioxane-4,6-dione |
| SMILES | CC(C)(C)C1(C)OC(=O)C(=Cc2ccc(O)c([N+](=O)[O-])c2)C(=O)O1 |
| InChI | InChI=1S/C16H17NO7/c1-15(2,3)16(4)23-13(19)10(14(20)24-16)7-9-5-6-12(18)11(8-9)17(21)22/h5-8,18H,1-4H3/b10-7- |
| InChIKey | CAKGZLAQIDJNAV-YFHOEESVSA-N |
| XLogP | 2.55 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|