C16H15NO7 — CID 1490808
3-[(4-hydroxy-3-nitrophenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 1490808) has the molecular formula C16H15NO7 and a molecular weight of 333.30 g/mol. Its IUPAC name is 3-[(4-hydroxy-3-nitrophenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[(4-hydroxy-3-nitrophenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 1490808 |
| Molecular Formula | C16H15NO7 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-[(4-hydroxy-3-nitrophenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1OC2(CCCCC2)OC(=O)C1=Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15NO7/c18-13-5-4-10(9-12(13)17(21)22)8-11-14(19)23-16(24-15(11)20)6-2-1-3-7-16/h4-5,8-9,18H,1-3,6-7H2 |
| InChIKey | ZYBDNFIIRFQLEQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|