C18H20O6 — CID 50887631
3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 50887631) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 50887631 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | CCOc1cc(C=C2C(=O)OC3(CCCCC3)OC2=O)ccc1O |
| InChI | InChI=1S/C18H20O6/c1-2-22-15-11-12(6-7-14(15)19)10-13-16(20)23-18(24-17(13)21)8-4-3-5-9-18/h6-7,10-11,19H,2-5,8-9H2,1H3 |
| InChIKey | ZOPDBGSDGIDSOE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|