C25H24O8 — CID 1027004
3-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 1027004) has the molecular formula C25H24O8 and a molecular weight of 452.46 g/mol. Its IUPAC name is 3-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 1027004 |
| Molecular Formula | C25H24O8 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-[[4-[(2,4-dioxo-1,5-dioxaspiro[5.5]undecan-3-ylidene)methyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=C2C(=O)OC3(CCCCC3)OC2=O)ccc1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H24O8/c1-30-21-14-16(8-9-20(21)31-15-17-6-5-7-18(12-17)22(26)27)13-19-23(28)32-25(33-24(19)29)10-3-2-4-11-25/h5-9,12-14H,2-4,10-11,15H2,1H3,(H,26,27) |
| InChIKey | QQMCBBRBGNFNCJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|