C16H16O6 — CID 4526453
8-[(3-hydroxy-4-methoxyphenyl)methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 4526453) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 8-[(3-hydroxy-4-methoxyphenyl)methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[(3-hydroxy-4-methoxyphenyl)methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 4526453 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 8-[(3-hydroxy-4-methoxyphenyl)methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | COc1ccc(C=C2C(=O)OC3(CCCC3)OC2=O)cc1O |
| InChI | InChI=1S/C16H16O6/c1-20-13-5-4-10(9-12(13)17)8-11-14(18)21-16(22-15(11)19)6-2-3-7-16/h4-5,8-9,17H,2-3,6-7H2,1H3 |
| InChIKey | WSXQYYLXUBNKPD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|