C13H11NO8 — CID 168599567
5-[(2,4-dihydroxy-5-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599567) has the molecular formula C13H11NO8 and a molecular weight of 309.23 g/mol. Its IUPAC name is 5-[(2,4-dihydroxy-5-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2,4-dihydroxy-5-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599567 |
| Molecular Formula | C13H11NO8 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 5-[(2,4-dihydroxy-5-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2cc([N+](=O)[O-])c(O)cc2O)C(=O)O1 |
| InChI | InChI=1S/C13H11NO8/c1-13(2)21-11(17)7(12(18)22-13)3-6-4-8(14(19)20)10(16)5-9(6)15/h3-5,15-16H,1-2H3 |
| InChIKey | BMEGTPMLTRDQKF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|