C14H12ClNO7 — CID 168597756
5-[(5-chloro-2-hydroxy-4-methyl-3-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168597756) has the molecular formula C14H12ClNO7 and a molecular weight of 341.70 g/mol. Its IUPAC name is 5-[(5-chloro-2-hydroxy-4-methyl-3-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(5-chloro-2-hydroxy-4-methyl-3-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168597756 |
| Molecular Formula | C14H12ClNO7 |
| Molecular Weight | 341.70 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 5-[(5-chloro-2-hydroxy-4-methyl-3-nitrophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1c(Cl)cc(C=C2C(=O)OC(C)(C)OC2=O)c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12ClNO7/c1-6-9(15)5-7(11(17)10(6)16(20)21)4-8-12(18)22-14(2,3)23-13(8)19/h4-5,17H,1-3H3 |
| InChIKey | PHOQSHRDNVBXDE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|