C18H18F3NO4 — CID 168597714
2,2-dimethyl-5-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168597714) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168597714 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2,2-dimethyl-5-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(N3CCCC3)c(C(F)(F)F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H18F3NO4/c1-17(2)25-15(23)12(16(24)26-17)9-11-5-6-14(22-7-3-4-8-22)13(10-11)18(19,20)21/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | VBNNACYSFCYHRX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|