C11H13O4 — CID 11296096
CID 11296096 (PubChem CID 11296096) has the molecular formula C11H13O4 and a molecular weight of 209.22 g/mol.
| Compound Name | CID 11296096 |
|---|---|
| PubChem CID | 11296096 |
| Molecular Formula | C11H13O4 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | — |
| SMILES | [CH2][C](C)[CH]C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C11H13O4/c1-7(2)5-6-8-9(12)14-11(3,4)15-10(8)13/h5-6H,1H2,2-4H3 |
| InChIKey | CPAMCZOTTVYUIN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|