C15H19NO6 — CID 58426301
5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 58426301) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 58426301 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(=O)CN(/C=C/C=C1C(=O)OC(C)(C)OC1=O)CC(C)=O |
| InChI | InChI=1S/C15H19NO6/c1-10(17)8-16(9-11(2)18)7-5-6-12-13(19)21-15(3,4)22-14(12)20/h5-7H,8-9H2,1-4H3/b7-5+ |
| InChIKey | ULKJWAFKVHMVAN-FNORWQNLSA-N |
| XLogP | 0.74 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|