C10H12O6S — CID 10422714
3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylsulfanyl]propanoic acid (PubChem CID 10422714) has the molecular formula C10H12O6S and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylsulfanyl]propanoic acid.
| Compound Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10422714 |
| Molecular Formula | C10H12O6S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylsulfanyl]propanoic acid |
| SMILES | CC1(C)OC(=O)C(=CSCCC(=O)O)C(=O)O1 |
| InChI | InChI=1S/C10H12O6S/c1-10(2)15-8(13)6(9(14)16-10)5-17-4-3-7(11)12/h5H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | YBHMZAAPONWWGA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|