C17H23NO5 — CID 6393397
5-[(2Z,4E)-5-(azepan-1-yl)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 6393397) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 5-[(2Z,4E)-5-(azepan-1-yl)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2Z,4E)-5-(azepan-1-yl)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 6393397 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 5-[(2Z,4E)-5-(azepan-1-yl)-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C/C(O)=C/C=C/N2CCCCCC2)C(=O)O1 |
| InChI | InChI=1S/C17H23NO5/c1-17(2)22-15(20)14(16(21)23-17)12-13(19)8-7-11-18-9-5-3-4-6-10-18/h7-8,11-12,19H,3-6,9-10H2,1-2H3/b11-7+,13-8- |
| InChIKey | FVIXNGBENKBKNZ-NVGJIZNYSA-N |
| XLogP | 2.58 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|