C21H19O12- — CID 58831368
12-[(E)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,4,13-trioxo-1,5,10,14-tetraoxadispiro[5.2.59.26]hexadec-11-en-11-olate (PubChem CID 58831368) has the molecular formula C21H19O12- and a molecular weight of 463.37 g/mol. Its IUPAC name is 12-[(E)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,4,13-trioxo-1,5,10,14-tetraoxadispiro[5.2.59.26]hexadec-11-en-11-olate.
| Compound Name | 12-[(E)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,4,13-trioxo-1,5,10,14-tetraoxadispiro[5.2.59.26]hexadec-11-en-11-olate |
|---|---|
| PubChem CID | 58831368 |
| Molecular Formula | C21H19O12- |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 12-[(E)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,4,13-trioxo-1,5,10,14-tetraoxadispiro[5.2.59.26]hexadec-11-en-11-olate |
| SMILES | CC1(C)OC(=O)C(=C/C=C/C2=C([O-])OC3(CCC4(CC3)OC(=O)CC(=O)O4)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C21H20O12/c1-19(2)30-15(24)11(16(25)31-19)4-3-5-12-17(26)32-21(33-18(12)27)8-6-20(7-9-21)28-13(22)10-14(23)29-20/h3-5,26H,6-10H2,1-2H3/p-1/b5-3+ |
| InChIKey | FMBOQJMRPTYINV-HWKANZROSA-M |
| XLogP | -0.09 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|