C25H31O8- — CID 20754277
2-cyclohexyl-5-[(E)-3-(2-cyclohexyl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2-methyl-6-oxo-1,3-dioxin-4-olate (PubChem CID 20754277) has the molecular formula C25H31O8- and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-cyclohexyl-5-[(E)-3-(2-cyclohexyl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2-methyl-6-oxo-1,3-dioxin-4-olate.
| Compound Name | 2-cyclohexyl-5-[(E)-3-(2-cyclohexyl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2-methyl-6-oxo-1,3-dioxin-4-olate |
|---|---|
| PubChem CID | 20754277 |
| Molecular Formula | C25H31O8- |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-cyclohexyl-5-[(E)-3-(2-cyclohexyl-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2-methyl-6-oxo-1,3-dioxin-4-olate |
| SMILES | CC1(C2CCCCC2)OC(=O)C(=C/C=C/C2=C([O-])OC(C)(C3CCCCC3)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C25H32O8/c1-24(16-10-5-3-6-11-16)30-20(26)18(21(27)31-24)14-9-15-19-22(28)32-25(2,33-23(19)29)17-12-7-4-8-13-17/h9,14-17,26H,3-8,10-13H2,1-2H3/p-1/b14-9+,19-15- |
| InChIKey | ZNSKETKNIJAUIG-DTWMHPQNSA-M |
| XLogP | 3.31 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|